C22H18N6O3 — CID 43865025
8-[(4-methoxyphenyl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione (PubChem CID 43865025) has the molecular formula C22H18N6O3 and a molecular weight of 414.43 g/mol. Its IUPAC name is 8-[(4-methoxyphenyl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione.
| Compound Name | 8-[(4-methoxyphenyl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
|---|---|
| PubChem CID | 43865025 |
| Molecular Formula | C22H18N6O3 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 8-[(4-methoxyphenyl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
| SMILES | COc1ccc(Cn2ccc3nc4ccn(-c5n[nH]c(C)n5)c(=O)c4cc3c2=O)cc1 |
| InChI | InChI=1S/C22H18N6O3/c1-13-23-22(26-25-13)28-10-8-19-17(21(28)30)11-16-18(24-19)7-9-27(20(16)29)12-14-3-5-15(31-2)6-4-14/h3-11H,12H2,1-2H3,(H,23,25,26) |
| InChIKey | LWKBIRXGIPSBAN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|