C21H20N6O2 — CID 43865106
8-[2-(cyclohexen-1-yl)ethyl]-2-(1H-1,2,4-triazol-5-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione (PubChem CID 43865106) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 8-[2-(cyclohexen-1-yl)ethyl]-2-(1H-1,2,4-triazol-5-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione.
| Compound Name | 8-[2-(cyclohexen-1-yl)ethyl]-2-(1H-1,2,4-triazol-5-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
|---|---|
| PubChem CID | 43865106 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 8-[2-(cyclohexen-1-yl)ethyl]-2-(1H-1,2,4-triazol-5-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
| SMILES | O=c1c2cc3c(=O)n(-c4ncn[nH]4)ccc3nc2ccn1CCC1=CCCCC1 |
| InChI | InChI=1S/C21H20N6O2/c28-19-15-12-16-18(8-11-27(20(16)29)21-22-13-23-25-21)24-17(15)7-10-26(19)9-6-14-4-2-1-3-5-14/h4,7-8,10-13H,1-3,5-6,9H2,(H,22,23,25) |
| InChIKey | RWOLHWKXJGEHHJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|