C19H18BrN3OS — CID 43926571
[5-[(2-bromophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-phenylmethanol (PubChem CID 43926571) has the molecular formula C19H18BrN3OS and a molecular weight of 416.34 g/mol. Its IUPAC name is [5-[(2-bromophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-phenylmethanol.
| Compound Name | [5-[(2-bromophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-phenylmethanol |
|---|---|
| PubChem CID | 43926571 |
| Molecular Formula | C19H18BrN3OS |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | [5-[(2-bromophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-phenylmethanol |
| SMILES | C=CCn1c(SCc2ccccc2Br)nnc1C(O)c1ccccc1 |
| InChI | InChI=1S/C19H18BrN3OS/c1-2-12-23-18(17(24)14-8-4-3-5-9-14)21-22-19(23)25-13-15-10-6-7-11-16(15)20/h2-11,17,24H,1,12-13H2 |
| InChIKey | GBPJXZMJBJUPSF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|