C9H13N3O4S — CID 43980556
5-piperidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione (PubChem CID 43980556) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is 5-piperidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-piperidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 43980556 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 5-piperidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(S(=O)(=O)N2CCCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H13N3O4S/c13-8-7(6-10-9(14)11-8)17(15,16)12-4-2-1-3-5-12/h6H,1-5H2,(H2,10,11,13,14) |
| InChIKey | DYUFKTRXVRQZPD-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |