C13H21N3O3 — CID 44506465
N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyhexanediamide (PubChem CID 44506465) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyhexanediamide.
| Compound Name | N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 44506465 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyhexanediamide |
| SMILES | O=C(CCCCC(=O)N/N=C/C1=CCCCC1)NO |
| InChI | InChI=1S/C13H21N3O3/c17-12(8-4-5-9-13(18)16-19)15-14-10-11-6-2-1-3-7-11/h6,10,19H,1-5,7-9H2,(H,15,17)(H,16,18)/b14-10+ |
| InChIKey | LXMVUPJBBWPYMF-GXDHUFHOSA-N |
| XLogP | 1.65 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|