C14H23N3O3 — CID 44507886
N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyheptanediamide (PubChem CID 44507886) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyheptanediamide.
| Compound Name | N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 44507886 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)N/N=C/C1=CCCCC1)NO |
| InChI | InChI=1S/C14H23N3O3/c18-13(9-5-2-6-10-14(19)17-20)16-15-11-12-7-3-1-4-8-12/h7,11,20H,1-6,8-10H2,(H,16,18)(H,17,19)/b15-11+ |
| InChIKey | KCQNWCMGROBTNK-RVDMUPIBSA-N |
| XLogP | 2.04 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|