C15H25N3O3 — CID 44507916
N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyoctanediamide (PubChem CID 44507916) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyoctanediamide.
| Compound Name | N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 44507916 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-[(E)-cyclohexen-1-ylmethylideneamino]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)N/N=C/C1=CCCCC1)NO |
| InChI | InChI=1S/C15H25N3O3/c19-14(10-6-1-2-7-11-15(20)18-21)17-16-12-13-8-4-3-5-9-13/h8,12,21H,1-7,9-11H2,(H,17,19)(H,18,20)/b16-12+ |
| InChIKey | MXPRQOCNJGKYLM-FOWTUZBSSA-N |
| XLogP | 2.43 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|