C18H31N3O3 — CID 44507880
N'-hydroxy-N-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]heptanediamide (PubChem CID 44507880) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is N'-hydroxy-N-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]heptanediamide.
| Compound Name | N'-hydroxy-N-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]heptanediamide |
|---|---|
| PubChem CID | 44507880 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | N'-hydroxy-N-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]heptanediamide |
| SMILES | CC1=C(C/C=N/NC(=O)CCCCCC(=O)NO)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H31N3O3/c1-14-8-7-12-18(2,3)15(14)11-13-19-20-16(22)9-5-4-6-10-17(23)21-24/h13,24H,4-12H2,1-3H3,(H,20,22)(H,21,23)/b19-13+ |
| InChIKey | CDPVWMJTUAGZCX-CPNJWEJPSA-N |
| XLogP | 3.46 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|