C18H30N2O3 — CID 23749411
7-oxo-7-[(2E)-2-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]hydrazinyl]heptanoic acid (PubChem CID 23749411) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 7-oxo-7-[(2E)-2-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]hydrazinyl]heptanoic acid.
| Compound Name | 7-oxo-7-[(2E)-2-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]hydrazinyl]heptanoic acid |
|---|---|
| PubChem CID | 23749411 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 7-oxo-7-[(2E)-2-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]hydrazinyl]heptanoic acid |
| SMILES | CC1=C(C/C=N/NC(=O)CCCCCC(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H30N2O3/c1-14-8-7-12-18(2,3)15(14)11-13-19-20-16(21)9-5-4-6-10-17(22)23/h13H,4-12H2,1-3H3,(H,20,21)(H,22,23)/b19-13+ |
| InChIKey | FNFNDPOZBRCKFO-CPNJWEJPSA-N |
| XLogP | 4.04 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|