C23H19N5O2 — CID 44513334
7,10-diphenyl-3,6,8,10,12-pentazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2,7-triene-5,11-dione (PubChem CID 44513334) has the molecular formula C23H19N5O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 7,10-diphenyl-3,6,8,10,12-pentazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2,7-triene-5,11-dione.
| Compound Name | 7,10-diphenyl-3,6,8,10,12-pentazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2,7-triene-5,11-dione |
|---|---|
| PubChem CID | 44513334 |
| Molecular Formula | C23H19N5O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 7,10-diphenyl-3,6,8,10,12-pentazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2,7-triene-5,11-dione |
| SMILES | O=C1CN=C2C3=C(N=C(c4ccccc4)N12)N(c1ccccc1)C(=O)N1CCCC31 |
| InChI | InChI=1S/C23H19N5O2/c29-18-14-24-21-19-17-12-7-13-26(17)23(30)27(16-10-5-2-6-11-16)22(19)25-20(28(18)21)15-8-3-1-4-9-15/h1-6,8-11,17H,7,12-14H2 |
| InChIKey | GVNDVULYKUKBJE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |