C18H17NO4 — CID 44514830
(5-methoxy-1,3-dimethylindol-2-yl) phenyl carbonate (PubChem CID 44514830) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (5-methoxy-1,3-dimethylindol-2-yl) phenyl carbonate.
| Compound Name | (5-methoxy-1,3-dimethylindol-2-yl) phenyl carbonate |
|---|---|
| PubChem CID | 44514830 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (5-methoxy-1,3-dimethylindol-2-yl) phenyl carbonate |
| SMILES | COc1ccc2c(c1)c(C)c(OC(=O)Oc1ccccc1)n2C |
| InChI | InChI=1S/C18H17NO4/c1-12-15-11-14(21-3)9-10-16(15)19(2)17(12)23-18(20)22-13-7-5-4-6-8-13/h4-11H,1-3H3 |
| InChIKey | FLMPCUVAFYKZHL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|