C20H22N4O5S2 — CID 44516733
5-[1,2-bis(benzenesulfonyl)ethyl]-4,6-diimino-1,3-dimethyl-1,3-diazinan-2-one (PubChem CID 44516733) has the molecular formula C20H22N4O5S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 5-[1,2-bis(benzenesulfonyl)ethyl]-4,6-diimino-1,3-dimethyl-1,3-diazinan-2-one.
| Compound Name | 5-[1,2-bis(benzenesulfonyl)ethyl]-4,6-diimino-1,3-dimethyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 44516733 |
| Molecular Formula | C20H22N4O5S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 5-[1,2-bis(benzenesulfonyl)ethyl]-4,6-diimino-1,3-dimethyl-1,3-diazinan-2-one |
| SMILES | [H]/N=C1/C(C(CS(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)/C(=N/[H])N(C)C(=O)N1C |
| InChI | InChI=1S/C20H22N4O5S2/c1-23-18(21)17(19(22)24(2)20(23)25)16(31(28,29)15-11-7-4-8-12-15)13-30(26,27)14-9-5-3-6-10-14/h3-12,16-17,21-22H,13H2,1-2H3/b21-18-,22-19- |
| InChIKey | YPGWPXDLKVQGGS-FRRVGIRPSA-N |
| XLogP | 1.87 |
| TPSA | 139.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|