C30H43NO9Si — CID 44517436
[(2R,3S,4R,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-4-hydroxy-2-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate (PubChem CID 44517436) has the molecular formula C30H43NO9Si and a molecular weight of 589.76 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-4-hydroxy-2-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-4-hydroxy-2-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 44517436 |
| Molecular Formula | C30H43NO9Si |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-4-hydroxy-2-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@H]1[C@H](O)[C@@H](N2C(=O)C(C)=C(C)C2=O)[C@H](O[Si](C)(C)C(C)(C)C)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C30H43NO9Si/c1-18(32)14-15-23(33)39-26-22(17-37-16-21-12-10-9-11-13-21)38-29(40-41(7,8)30(4,5)6)24(25(26)34)31-27(35)19(2)20(3)28(31)36/h9-13,22,24-26,29,34H,14-17H2,1-8H3/t22-,24-,25-,26-,29+/m1/s1 |
| InChIKey | QFWYCCOSCLPXDN-JJMUUSAGSA-N |
| XLogP | 3.67 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|