C26H29F3N4O — CID 44524829
N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]-1H-indole-2-carboxamide (PubChem CID 44524829) has the molecular formula C26H29F3N4O and a molecular weight of 470.54 g/mol. Its IUPAC name is N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]-1H-indole-2-carboxamide.
| Compound Name | N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 44524829 |
| Molecular Formula | C26H29F3N4O |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCC(N2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H29F3N4O/c27-26(28,29)19-5-3-6-22(17-19)33-14-12-32(13-15-33)21-10-8-20(9-11-21)30-25(34)24-16-18-4-1-2-7-23(18)31-24/h1-7,16-17,20-21,31H,8-15H2,(H,30,34) |
| InChIKey | DPLHZOVMOUDFQJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |