C22H21FN2O3 — CID 44526172
N-[4-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxyphenyl]furan-2-carboxamide (PubChem CID 44526172) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is N-[4-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxyphenyl]furan-2-carboxamide.
| Compound Name | N-[4-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 44526172 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[4-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxyphenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CCN(Cc3ccc(F)cc3)C2)cc1)c1ccco1 |
| InChI | InChI=1S/C22H21FN2O3/c23-17-5-3-16(4-6-17)14-25-12-11-20(15-25)28-19-9-7-18(8-10-19)24-22(26)21-2-1-13-27-21/h1-10,13,20H,11-12,14-15H2,(H,24,26) |
| InChIKey | UTFCCRMIUBBRKK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |