C25H33ClIN3O2 — CID 44534329
2-[3-[(3-tert-butyl-2-ethoxy-5-iodophenyl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride (PubChem CID 44534329) has the molecular formula C25H33ClIN3O2 and a molecular weight of 569.92 g/mol. Its IUPAC name is 2-[3-[(3-tert-butyl-2-ethoxy-5-iodophenyl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride.
| Compound Name | 2-[3-[(3-tert-butyl-2-ethoxy-5-iodophenyl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 44534329 |
| Molecular Formula | C25H33ClIN3O2 |
| Molecular Weight | 569.92 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | 2-[3-[(3-tert-butyl-2-ethoxy-5-iodophenyl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride |
| SMILES | CCOc1c(CNCCCNc2cc(=O)c3ccccc3[nH]2)cc(I)cc1C(C)(C)C.Cl |
| InChI | InChI=1S/C25H32IN3O2.ClH/c1-5-31-24-17(13-18(26)14-20(24)25(2,3)4)16-27-11-8-12-28-23-15-22(30)19-9-6-7-10-21(19)29-23;/h6-7,9-10,13-15,27H,5,8,11-12,16H2,1-4H3,(H2,28,29,30);1H |
| InChIKey | LOMBKMQKIURBQI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.92 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|