C20H24Cl2F3N3OS — CID 91800518
2-[3-[[2,5-dimethyl-4-(trifluoromethyl)thiophen-3-yl]methylamino]propylamino]-1H-quinolin-4-one;dihydrochloride (PubChem CID 91800518) has the molecular formula C20H24Cl2F3N3OS and a molecular weight of 482.40 g/mol. Its IUPAC name is 2-[3-[[2,5-dimethyl-4-(trifluoromethyl)thiophen-3-yl]methylamino]propylamino]-1H-quinolin-4-one;dihydrochloride.
| Compound Name | 2-[3-[[2,5-dimethyl-4-(trifluoromethyl)thiophen-3-yl]methylamino]propylamino]-1H-quinolin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 91800518 |
| Molecular Formula | C20H24Cl2F3N3OS |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 2-[3-[[2,5-dimethyl-4-(trifluoromethyl)thiophen-3-yl]methylamino]propylamino]-1H-quinolin-4-one;dihydrochloride |
| SMILES | Cc1sc(C)c(C(F)(F)F)c1CNCCCNc1cc(=O)c2ccccc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C20H22F3N3OS.2ClH/c1-12-15(19(13(2)28-12)20(21,22)23)11-24-8-5-9-25-18-10-17(27)14-6-3-4-7-16(14)26-18;;/h3-4,6-7,10,24H,5,8-9,11H2,1-2H3,(H2,25,26,27);2*1H |
| InChIKey | KVXGBDYRDFOMRM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|