C19H20Cl5N3O — CID 18353654
2-[3-[(2,3,5-trichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one;dihydrochloride (PubChem CID 18353654) has the molecular formula C19H20Cl5N3O and a molecular weight of 483.65 g/mol. Its IUPAC name is 2-[3-[(2,3,5-trichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one;dihydrochloride.
| Compound Name | 2-[3-[(2,3,5-trichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 18353654 |
| Molecular Formula | C19H20Cl5N3O |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | 2-[3-[(2,3,5-trichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one;dihydrochloride |
| SMILES | Cl.Cl.O=c1cc(NCCCNCc2cc(Cl)cc(Cl)c2Cl)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18Cl3N3O.2ClH/c20-13-8-12(19(22)15(21)9-13)11-23-6-3-7-24-18-10-17(26)14-4-1-2-5-16(14)25-18;;/h1-2,4-5,8-10,23H,3,6-7,11H2,(H2,24,25,26);2*1H |
| InChIKey | RSKHHBTVOXEJLK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|