C26H35N3O6S — CID 44538613
N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-(1,1-dioxothiazinan-2-yl)benzamide (PubChem CID 44538613) has the molecular formula C26H35N3O6S and a molecular weight of 517.65 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-(1,1-dioxothiazinan-2-yl)benzamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-(1,1-dioxothiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 44538613 |
| Molecular Formula | C26H35N3O6S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-(1,1-dioxothiazinan-2-yl)benzamide |
| SMILES | C[C@H]1CN(C(=O)[C@@H](NC(=O)c2ccc(N3CCCCS3(=O)=O)cc2)C2(C)CCCC2)[C@@H]2C(=O)CO[C@@H]21 |
| InChI | InChI=1S/C26H35N3O6S/c1-17-15-28(21-20(30)16-35-22(17)21)25(32)23(26(2)11-3-4-12-26)27-24(31)18-7-9-19(10-8-18)29-13-5-6-14-36(29,33)34/h7-10,17,21-23H,3-6,11-16H2,1-2H3,(H,27,31)/t17-,21+,22+,23+/m0/s1 |
| InChIKey | BVXKURCAPOPUNF-XCYUPCBOSA-N |
| XLogP | 2.11 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |