C22H29N3O6S — CID 44538307
N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-sulfamoylbenzamide (PubChem CID 44538307) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-sulfamoylbenzamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 44538307 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-sulfamoylbenzamide |
| SMILES | C[C@H]1CN(C(=O)[C@@H](NC(=O)c2ccc(S(N)(=O)=O)cc2)C2(C)CCCC2)[C@@H]2C(=O)CO[C@@H]21 |
| InChI | InChI=1S/C22H29N3O6S/c1-13-11-25(17-16(26)12-31-18(13)17)21(28)19(22(2)9-3-4-10-22)24-20(27)14-5-7-15(8-6-14)32(23,29)30/h5-8,13,17-19H,3-4,9-12H2,1-2H3,(H,24,27)(H2,23,29,30)/t13-,17+,18+,19+/m0/s1 |
| InChIKey | SLYYNUCKYMBGCS-JGNHQEBTSA-N |
| XLogP | 0.83 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |