C26H35N3O5 — CID 69004872
N-[2-[(3aS,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-(2-methylpropanoylamino)benzamide (PubChem CID 69004872) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is N-[2-[(3aS,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-(2-methylpropanoylamino)benzamide.
| Compound Name | N-[2-[(3aS,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 69004872 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | N-[2-[(3aS,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-4-(2-methylpropanoylamino)benzamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)NC(C(=O)N2CC(C)[C@H]3OCC(=O)[C@H]32)C2(C)CCCC2)cc1 |
| InChI | InChI=1S/C26H35N3O5/c1-15(2)23(31)27-18-9-7-17(8-10-18)24(32)28-22(26(4)11-5-6-12-26)25(33)29-13-16(3)21-20(29)19(30)14-34-21/h7-10,15-16,20-22H,5-6,11-14H2,1-4H3,(H,27,31)(H,28,32)/t16?,20-,21-,22?/m1/s1 |
| InChIKey | RHFIBVXXOHUALR-YMFKYVHRSA-N |
| XLogP | 2.77 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |