C26H34IN3O5 — CID 69003673
N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-[1-(iodomethyl)cyclopentyl]-2-oxoethyl]-4-(2-methylpropanoylamino)benzamide (PubChem CID 69003673) has the molecular formula C26H34IN3O5 and a molecular weight of 595.48 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-[1-(iodomethyl)cyclopentyl]-2-oxoethyl]-4-(2-methylpropanoylamino)benzamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-[1-(iodomethyl)cyclopentyl]-2-oxoethyl]-4-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 69003673 |
| Molecular Formula | C26H34IN3O5 |
| Molecular Weight | 595.48 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-[1-(iodomethyl)cyclopentyl]-2-oxoethyl]-4-(2-methylpropanoylamino)benzamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)N[C@H](C(=O)N2C[C@H](C)[C@H]3OCC(=O)[C@H]32)C2(CI)CCCC2)cc1 |
| InChI | InChI=1S/C26H34IN3O5/c1-15(2)23(32)28-18-8-6-17(7-9-18)24(33)29-22(26(14-27)10-4-5-11-26)25(34)30-12-16(3)21-20(30)19(31)13-35-21/h6-9,15-16,20-22H,4-5,10-14H2,1-3H3,(H,28,32)(H,29,33)/t16-,20+,21+,22+/m0/s1 |
| InChIKey | SYXNJWRWYJWPCA-JJCGOBCMSA-N |
| XLogP | 3.19 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|