C23H27N3O5S — CID 44538311
N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-2-oxo-3H-1,3-benzothiazole-6-carboxamide (PubChem CID 44538311) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-2-oxo-3H-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-2-oxo-3H-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 44538311 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-2-oxo-3H-1,3-benzothiazole-6-carboxamide |
| SMILES | C[C@H]1CN(C(=O)[C@@H](NC(=O)c2ccc3[nH]c(=O)sc3c2)C2(C)CCCC2)[C@@H]2C(=O)CO[C@@H]21 |
| InChI | InChI=1S/C23H27N3O5S/c1-12-10-26(17-15(27)11-31-18(12)17)21(29)19(23(2)7-3-4-8-23)25-20(28)13-5-6-14-16(9-13)32-22(30)24-14/h5-6,9,12,17-19H,3-4,7-8,10-11H2,1-2H3,(H,24,30)(H,25,28)/t12-,17+,18+,19+/m0/s1 |
| InChIKey | OSBSOWXYVLVKSB-VEFTVXKRSA-N |
| XLogP | 2.08 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |