C23H28N4O4S — CID 44539419
N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-2-amino-1,3-benzothiazole-6-carboxamide (PubChem CID 44539419) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-2-amino-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-2-amino-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 44539419 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-(1-methylcyclopentyl)-2-oxoethyl]-2-amino-1,3-benzothiazole-6-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)[C@@H](NC(=O)c2ccc3nc(N)sc3c2)C2(C)CCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C23H28N4O4S/c1-12-10-27(17-15(28)11-31-18(12)17)21(30)19(23(2)7-3-4-8-23)26-20(29)13-5-6-14-16(9-13)32-22(24)25-14/h5-6,9,12,17-19H,3-4,7-8,10-11H2,1-2H3,(H2,24,25)(H,26,29)/t12-,17-,18-,19-/m1/s1 |
| InChIKey | RLTOCKCLMMORFT-HAFFEQERSA-N |
| XLogP | 2.37 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |