C34H29ClO12 — CID 44545655
[8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 44545655) has the molecular formula C34H29ClO12 and a molecular weight of 665.05 g/mol. Its IUPAC name is [8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | [8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 44545655 |
| Molecular Formula | C34H29ClO12 |
| Molecular Weight | 665.05 g/mol |
| Exact Mass | 664.13 |
| IUPAC Name | [8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | COc1cc(C2c3cc4c(cc3C(OC(=O)COc3ccc5c(C)c(Cl)c(=O)oc5c3)C3COC(=O)C23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C34H29ClO12/c1-15-18-6-5-17(9-22(18)46-34(38)30(15)35)42-13-27(36)47-31-20-11-24-23(44-14-45-24)10-19(20)28(29-21(31)12-43-33(29)37)16-7-25(39-2)32(41-4)26(8-16)40-3/h5-11,21,28-29,31H,12-14H2,1-4H3 |
| InChIKey | QHXPBPAQLSFEOH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 138.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.05 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|