C32H40O4 — CID 44565754
(1R,3Z,5S,7S)-3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)-5-(2-methylprop-1-enyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 44565754) has the molecular formula C32H40O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is (1R,3Z,5S,7S)-3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)-5-(2-methylprop-1-enyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | (1R,3Z,5S,7S)-3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)-5-(2-methylprop-1-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 44565754 |
| Molecular Formula | C32H40O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | (1R,3Z,5S,7S)-3-[hydroxy(phenyl)methylidene]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)-5-(2-methylprop-1-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | CC(C)=CC[C@H]1C[C@@]2(CC=C(C)C)C(=O)/C(=C(/O)c3ccccc3)C(=O)[C@](C=C(C)C)(C2=O)C1(C)C |
| InChI | InChI=1S/C32H40O4/c1-20(2)14-15-24-19-31(17-16-21(3)4)27(34)25(26(33)23-12-10-9-11-13-23)28(35)32(29(31)36,18-22(5)6)30(24,7)8/h9-14,16,18,24,33H,15,17,19H2,1-8H3/b26-25-/t24-,31-,32+/m0/s1 |
| InChIKey | NYYZFIZSISQZIP-QXDKVTENSA-N |
| XLogP | 7.37 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|