C17H19N3 — CID 44580516
N-cyclohexyl-5H-pyrido[4,3-b]indol-1-amine (PubChem CID 44580516) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is N-cyclohexyl-5H-pyrido[4,3-b]indol-1-amine.
| Compound Name | N-cyclohexyl-5H-pyrido[4,3-b]indol-1-amine |
|---|---|
| PubChem CID | 44580516 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | N-cyclohexyl-5H-pyrido[4,3-b]indol-1-amine |
| SMILES | c1ccc2c(c1)[nH]c1ccnc(NC3CCCCC3)c12 |
| InChI | InChI=1S/C17H19N3/c1-2-6-12(7-3-1)19-17-16-13-8-4-5-9-14(13)20-15(16)10-11-18-17/h4-5,8-12,20H,1-3,6-7H2,(H,18,19) |
| InChIKey | KQCOOFQMYJSORJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |