C20H19F3N4 — CID 44581670
2-(4-methylpiperazin-1-yl)-8-phenyl-6-(trifluoromethyl)quinoxaline (PubChem CID 44581670) has the molecular formula C20H19F3N4 and a molecular weight of 372.39 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-8-phenyl-6-(trifluoromethyl)quinoxaline.
| Compound Name | 2-(4-methylpiperazin-1-yl)-8-phenyl-6-(trifluoromethyl)quinoxaline |
|---|---|
| PubChem CID | 44581670 |
| Molecular Formula | C20H19F3N4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-8-phenyl-6-(trifluoromethyl)quinoxaline |
| SMILES | CN1CCN(c2cnc3cc(C(F)(F)F)cc(-c4ccccc4)c3n2)CC1 |
| InChI | InChI=1S/C20H19F3N4/c1-26-7-9-27(10-8-26)18-13-24-17-12-15(20(21,22)23)11-16(19(17)25-18)14-5-3-2-4-6-14/h2-6,11-13H,7-10H2,1H3 |
| InChIKey | XBGVVGJFLKPDFX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |