C25H25N5O — CID 44591258
N-(2-amino-5-phenylphenyl)-4-[(1,5-dimethylpyrazol-4-yl)methylamino]benzamide (PubChem CID 44591258) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-[(1,5-dimethylpyrazol-4-yl)methylamino]benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-[(1,5-dimethylpyrazol-4-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 44591258 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-[(1,5-dimethylpyrazol-4-yl)methylamino]benzamide |
| SMILES | Cc1c(CNc2ccc(C(=O)Nc3cc(-c4ccccc4)ccc3N)cc2)cnn1C |
| InChI | InChI=1S/C25H25N5O/c1-17-21(16-28-30(17)2)15-27-22-11-8-19(9-12-22)25(31)29-24-14-20(10-13-23(24)26)18-6-4-3-5-7-18/h3-14,16,27H,15,26H2,1-2H3,(H,29,31) |
| InChIKey | XIFCOCFVEFTGAZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|