C20H15BrO7 — CID 44593019
8-(3-bromo-4,5-dimethoxyphenyl)-2,5,12,14-tetraoxatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one (PubChem CID 44593019) has the molecular formula C20H15BrO7 and a molecular weight of 447.24 g/mol. Its IUPAC name is 8-(3-bromo-4,5-dimethoxyphenyl)-2,5,12,14-tetraoxatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one.
| Compound Name | 8-(3-bromo-4,5-dimethoxyphenyl)-2,5,12,14-tetraoxatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one |
|---|---|
| PubChem CID | 44593019 |
| Molecular Formula | C20H15BrO7 |
| Molecular Weight | 447.24 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 8-(3-bromo-4,5-dimethoxyphenyl)-2,5,12,14-tetraoxatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one |
| SMILES | COc1cc(C2C3=C(COC3=O)Oc3cc4c(cc32)OCO4)cc(Br)c1OC |
| InChI | InChI=1S/C20H15BrO7/c1-23-15-4-9(3-11(21)19(15)24-2)17-10-5-13-14(27-8-26-13)6-12(10)28-16-7-25-20(22)18(16)17/h3-6,17H,7-8H2,1-2H3 |
| InChIKey | WTUIFFXUOLBGHP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |