C28H22O8 — CID 166834491
[2,6-dimethoxy-4-[(5R)-6-oxo-8,9-dihydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]phenyl] benzoate (PubChem CID 166834491) has the molecular formula C28H22O8 and a molecular weight of 486.48 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(5R)-6-oxo-8,9-dihydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]phenyl] benzoate.
| Compound Name | [2,6-dimethoxy-4-[(5R)-6-oxo-8,9-dihydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 166834491 |
| Molecular Formula | C28H22O8 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [2,6-dimethoxy-4-[(5R)-6-oxo-8,9-dihydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]phenyl] benzoate |
| SMILES | COc1cc([C@H]2C3=C(COC3=O)Cc3cc4c(cc32)OCO4)cc(OC)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H22O8/c1-31-22-10-17(11-23(32-2)26(22)36-27(29)15-6-4-3-5-7-15)24-19-12-21-20(34-14-35-21)9-16(19)8-18-13-33-28(30)25(18)24/h3-7,9-12,24H,8,13-14H2,1-2H3/t24-/m1/s1 |
| InChIKey | TUUHTHHTDKVSQV-XMMPIXPASA-N |
| XLogP | 4.19 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|