About O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate
O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate (PubChem CID 44593382) has the molecular formula C16H17NOS
and a molecular weight of 271.39 g/mol. Its IUPAC name is O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate.
Molecular Properties
| Compound Name | O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate |
| PubChem CID | 44593382 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate |
| SMILES | Cc1ccc(NC(=S)OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NOS/c1-13-7-9-15(10-8-13)17-16(19)18-12-11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3,(H,17,19) |
| InChIKey | RABPAQDSNGTVAB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate?
The IUPAC name of O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate (CID 44593382) is O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate.
What is the SMILES notation for O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate?
The canonical SMILES for O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate is Cc1ccc(NC(=S)OCCc2ccccc2)cc1.
What is the InChIKey of O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate?
The InChIKey is RABPAQDSNGTVAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NOS/c1-13-7-9-15(10-8-13)17-16(19)18-12-11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3,(H,17,19).
What are the key properties of O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate?
O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate has a molecular weight of 271.39 g/mol, XLogP of 3.95, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-phenylethyl) N-(4-methylphenyl)carbamothioate is sourced from PubChem (CID 44593382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).