About 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate
2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate (PubChem CID 44595123) has the molecular formula C17H20N2O5
and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate |
| PubChem CID | 44595123 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate |
| SMILES | COc1ccc2c(C(=O)C(=O)OCCN3CCOCC3)c[nH]c2c1 |
| InChI | InChI=1S/C17H20N2O5/c1-22-12-2-3-13-14(11-18-15(13)10-12)16(20)17(21)24-9-6-19-4-7-23-8-5-19/h2-3,10-11,18H,4-9H2,1H3 |
| InChIKey | LTTVDUXKMLVIQS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate?
The IUPAC name of 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate (CID 44595123) is 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate.
What is the SMILES notation for 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate?
The canonical SMILES for 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate is COc1ccc2c(C(=O)C(=O)OCCN3CCOCC3)c[nH]c2c1.
What is the InChIKey of 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate?
The InChIKey is LTTVDUXKMLVIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O5/c1-22-12-2-3-13-14(11-18-15(13)10-12)16(20)17(21)24-9-6-19-4-7-23-8-5-19/h2-3,10-11,18H,4-9H2,1H3.
What are the key properties of 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate?
2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate has a molecular weight of 332.36 g/mol, XLogP of 1.23, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 2-(6-methoxy-1H-indol-3-yl)-2-oxoacetate is sourced from PubChem (CID 44595123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).