C18H18N4O3 — CID 44595586
6-[[2-(1-oxaspiro[4.4]nonan-9-ylamino)-3,4-dioxocyclobuten-1-yl]amino]pyridine-3-carbonitrile (PubChem CID 44595586) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 6-[[2-(1-oxaspiro[4.4]nonan-9-ylamino)-3,4-dioxocyclobuten-1-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[2-(1-oxaspiro[4.4]nonan-9-ylamino)-3,4-dioxocyclobuten-1-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 44595586 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 6-[[2-(1-oxaspiro[4.4]nonan-9-ylamino)-3,4-dioxocyclobuten-1-yl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(Nc2c(NC3CCCC34CCCO4)c(=O)c2=O)nc1 |
| InChI | InChI=1S/C18H18N4O3/c19-9-11-4-5-13(20-10-11)22-15-14(16(23)17(15)24)21-12-3-1-6-18(12)7-2-8-25-18/h4-5,10,12,21H,1-3,6-8H2,(H,20,22) |
| InChIKey | BHVBNODXUUZCBE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|