C25H48O7Si2 — CID 44598081
(2R,3R,4aR,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one (PubChem CID 44598081) has the molecular formula C25H48O7Si2 and a molecular weight of 516.82 g/mol. Its IUPAC name is (2R,3R,4aR,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one.
| Compound Name | (2R,3R,4aR,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one |
|---|---|
| PubChem CID | 44598081 |
| Molecular Formula | C25H48O7Si2 |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | (2R,3R,4aR,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one |
| SMILES | CO[C@]1(C)O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C=C(CO[Si](C)(C)C(C)(C)C)C(=O)[C@@H]2O[C@@]1(C)OC |
| InChI | InChI=1S/C25H48O7Si2/c1-22(2,3)33(11,12)29-16-17-15-18(32-34(13,14)23(4,5)6)20-21(19(17)26)31-25(8,28-10)24(7,27-9)30-20/h15,18,20-21H,16H2,1-14H3/t18-,20-,21-,24+,25+/m0/s1 |
| InChIKey | YVTKLZLJGFMCIL-XPMKPVRUSA-N |
| XLogP | 5.42 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|