C46H66N6O2 — CID 44605634
4-[2-[7-[bis(2-aminoethyl)amino]-9,9-dihexylfluoren-2-yl]ethynyl]-2-N,2-N,6-N,6-N-tetraethylpyridine-2,6-dicarboxamide (PubChem CID 44605634) has the molecular formula C46H66N6O2 and a molecular weight of 735.07 g/mol. Its IUPAC name is 4-[2-[7-[bis(2-aminoethyl)amino]-9,9-dihexylfluoren-2-yl]ethynyl]-2-N,2-N,6-N,6-N-tetraethylpyridine-2,6-dicarboxamide.
| Compound Name | 4-[2-[7-[bis(2-aminoethyl)amino]-9,9-dihexylfluoren-2-yl]ethynyl]-2-N,2-N,6-N,6-N-tetraethylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 44605634 |
| Molecular Formula | C46H66N6O2 |
| Molecular Weight | 735.07 g/mol |
| Exact Mass | 734.52 |
| IUPAC Name | 4-[2-[7-[bis(2-aminoethyl)amino]-9,9-dihexylfluoren-2-yl]ethynyl]-2-N,2-N,6-N,6-N-tetraethylpyridine-2,6-dicarboxamide |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C#Cc3cc(C(=O)N(CC)CC)nc(C(=O)N(CC)CC)c3)ccc2-c2ccc(N(CCN)CCN)cc21 |
| InChI | InChI=1S/C46H66N6O2/c1-7-13-15-17-25-46(26-18-16-14-8-2)40-31-35(21-23-38(40)39-24-22-37(34-41(39)46)52(29-27-47)30-28-48)19-20-36-32-42(44(53)50(9-3)10-4)49-43(33-36)45(54)51(11-5)12-6/h21-24,31-34H,7-18,25-30,47-48H2,1-6H3 |
| InChIKey | RDLSOHJTEFSWEQ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.07 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|