C14H17NO7 — CID 44606625
(3S,4R)-1-(1,3-dioxan-2-yl)-3,4-dihydroxy-4-(2-nitrophenyl)butan-2-one (PubChem CID 44606625) has the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. Its IUPAC name is (3S,4R)-1-(1,3-dioxan-2-yl)-3,4-dihydroxy-4-(2-nitrophenyl)butan-2-one.
| Compound Name | (3S,4R)-1-(1,3-dioxan-2-yl)-3,4-dihydroxy-4-(2-nitrophenyl)butan-2-one |
|---|---|
| PubChem CID | 44606625 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (3S,4R)-1-(1,3-dioxan-2-yl)-3,4-dihydroxy-4-(2-nitrophenyl)butan-2-one |
| SMILES | O=C(CC1OCCCO1)[C@@H](O)[C@H](O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17NO7/c16-11(8-12-21-6-3-7-22-12)14(18)13(17)9-4-1-2-5-10(9)15(19)20/h1-2,4-5,12-14,17-18H,3,6-8H2/t13-,14-/m1/s1 |
| InChIKey | XKDHJOTVABNKFE-ZIAGYGMSSA-N |
| XLogP | 0.71 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|