C11H11Cl2FN2O4 — CID 70548487
2,2-dichloro-N-[3-fluoro-1-hydroxy-1-(2-nitrophenyl)propan-2-yl]acetamide (PubChem CID 70548487) has the molecular formula C11H11Cl2FN2O4 and a molecular weight of 325.12 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-(2-nitrophenyl)propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-(2-nitrophenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 70548487 |
| Molecular Formula | C11H11Cl2FN2O4 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-(2-nitrophenyl)propan-2-yl]acetamide |
| SMILES | O=C(NC(CF)C(O)c1ccccc1[N+](=O)[O-])C(Cl)Cl |
| InChI | InChI=1S/C11H11Cl2FN2O4/c12-10(13)11(18)15-7(5-14)9(17)6-3-1-2-4-8(6)16(19)20/h1-4,7,9-10,17H,5H2,(H,15,18) |
| InChIKey | XXJXSZVKRXNNKZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|