C25H27F3N4O5 — CID 44609953
[(1S)-2-[4-[4-(diaminomethylidenecarbamoyl)-5-methoxy-2-(trifluoromethyl)phenyl]piperidin-1-yl]-2-oxo-1-phenylethyl] acetate (PubChem CID 44609953) has the molecular formula C25H27F3N4O5 and a molecular weight of 520.51 g/mol. Its IUPAC name is [(1S)-2-[4-[4-(diaminomethylidenecarbamoyl)-5-methoxy-2-(trifluoromethyl)phenyl]piperidin-1-yl]-2-oxo-1-phenylethyl] acetate.
| Compound Name | [(1S)-2-[4-[4-(diaminomethylidenecarbamoyl)-5-methoxy-2-(trifluoromethyl)phenyl]piperidin-1-yl]-2-oxo-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 44609953 |
| Molecular Formula | C25H27F3N4O5 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | [(1S)-2-[4-[4-(diaminomethylidenecarbamoyl)-5-methoxy-2-(trifluoromethyl)phenyl]piperidin-1-yl]-2-oxo-1-phenylethyl] acetate |
| SMILES | COc1cc(C2CCN(C(=O)[C@@H](OC(C)=O)c3ccccc3)CC2)c(C(F)(F)F)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C25H27F3N4O5/c1-14(33)37-21(16-6-4-3-5-7-16)23(35)32-10-8-15(9-11-32)17-13-20(36-2)18(22(34)31-24(29)30)12-19(17)25(26,27)28/h3-7,12-13,15,21H,8-11H2,1-2H3,(H4,29,30,31,34)/t21-/m0/s1 |
| InChIKey | RGXSMRIEGGESHY-NRFANRHFSA-N |
| XLogP | 3.14 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|