C26H33N6O9P — CID 44611543
(E)-but-2-enedioic acid;methyl (2S)-2-[2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-phenylpropanoate (PubChem CID 44611543) has the molecular formula C26H33N6O9P and a molecular weight of 604.56 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;methyl (2S)-2-[2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-phenylpropanoate.
| Compound Name | (E)-but-2-enedioic acid;methyl (2S)-2-[2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 44611543 |
| Molecular Formula | C26H33N6O9P |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | (E)-but-2-enedioic acid;methyl (2S)-2-[2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl]-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)N1CCCOP1(=O)CO[C@H](C)Cn1cnc2c(N)ncnc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H29N6O5P.C4H4O4/c1-16(12-27-14-26-19-20(23)24-13-25-21(19)27)32-15-34(30)28(9-6-10-33-34)18(22(29)31-2)11-17-7-4-3-5-8-17;5-3(6)1-2-4(7)8/h3-5,7-8,13-14,16,18H,6,9-12,15H2,1-2H3,(H2,23,24,25);1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-,18+,34?;/m1./s1 |
| InChIKey | YMHQCMPGGYYACT-YQEOSLRSSA-N |
| XLogP | 2.18 |
| TPSA | 209.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|