C21H27FN2O3 — CID 44614073
3-tert-butyl-1-cyclohexyl-5-[2-(4-fluorophenyl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 44614073) has the molecular formula C21H27FN2O3 and a molecular weight of 374.46 g/mol. Its IUPAC name is 3-tert-butyl-1-cyclohexyl-5-[2-(4-fluorophenyl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-tert-butyl-1-cyclohexyl-5-[2-(4-fluorophenyl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 44614073 |
| Molecular Formula | C21H27FN2O3 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 3-tert-butyl-1-cyclohexyl-5-[2-(4-fluorophenyl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CC(C)(C)N1C(=O)C(CC(=O)c2ccc(F)cc2)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C21H27FN2O3/c1-21(2,3)24-19(26)17(13-18(25)14-9-11-15(22)12-10-14)23(20(24)27)16-7-5-4-6-8-16/h9-12,16-17H,4-8,13H2,1-3H3 |
| InChIKey | FUVWEZONTCSVAK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|