C15H14NNa — CID 44632798
sodium (1S)-1-phenyl-3,4-dihydro-1H-isoquinolin-2-ide (PubChem CID 44632798) has the molecular formula C15H14NNa and a molecular weight of 231.27 g/mol. Its IUPAC name is sodium (1S)-1-phenyl-3,4-dihydro-1H-isoquinolin-2-ide.
| Compound Name | sodium (1S)-1-phenyl-3,4-dihydro-1H-isoquinolin-2-ide |
|---|---|
| PubChem CID | 44632798 |
| Molecular Formula | C15H14NNa |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | sodium (1S)-1-phenyl-3,4-dihydro-1H-isoquinolin-2-ide |
| SMILES | [Na+].c1ccc([C@@H]2[N-]CCc3ccccc32)cc1 |
| InChI | InChI=1S/C15H14N.Na/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;/h1-9,15H,10-11H2;/q-1;+1/t15-;/m0./s1 |
| InChIKey | KKONVOQPGLNDSU-RSAXXLAASA-N |
| XLogP | 0.71 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |