C13H18NY- — CID 59041499
1-tert-butyl-3,4-dihydro-1H-isoquinolin-2-ide;yttrium (PubChem CID 59041499) has the molecular formula C13H18NY- and a molecular weight of 277.20 g/mol. Its IUPAC name is 1-tert-butyl-3,4-dihydro-1H-isoquinolin-2-ide;yttrium.
| Compound Name | 1-tert-butyl-3,4-dihydro-1H-isoquinolin-2-ide;yttrium |
|---|---|
| PubChem CID | 59041499 |
| Molecular Formula | C13H18NY- |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-tert-butyl-3,4-dihydro-1H-isoquinolin-2-ide;yttrium |
| SMILES | CC(C)(C)C1[N-]CCc2ccccc21.[Y] |
| InChI | InChI=1S/C13H18N.Y/c1-13(2,3)12-11-7-5-4-6-10(11)8-9-14-12;/h4-7,12H,8-9H2,1-3H3;/q-1; |
| InChIKey | WIYWXNVTRYJQKH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |