C24H32P2 — CID 88895657
(2S)-2-tert-butyl-1-(2-tert-butyl-1,3-dihydroisophosphindol-1-yl)-1,3-dihydroisophosphindole (PubChem CID 88895657) has the molecular formula C24H32P2 and a molecular weight of 382.47 g/mol. Its IUPAC name is (2S)-2-tert-butyl-1-(2-tert-butyl-1,3-dihydroisophosphindol-1-yl)-1,3-dihydroisophosphindole.
| Compound Name | (2S)-2-tert-butyl-1-(2-tert-butyl-1,3-dihydroisophosphindol-1-yl)-1,3-dihydroisophosphindole |
|---|---|
| PubChem CID | 88895657 |
| Molecular Formula | C24H32P2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2S)-2-tert-butyl-1-(2-tert-butyl-1,3-dihydroisophosphindol-1-yl)-1,3-dihydroisophosphindole |
| SMILES | CC(C)(C)P1Cc2ccccc2C1C1c2ccccc2C[P@]1C(C)(C)C |
| InChI | InChI=1S/C24H32P2/c1-23(2,3)25-15-17-11-7-9-13-19(17)21(25)22-20-14-10-8-12-18(20)16-26(22)24(4,5)6/h7-14,21-22H,15-16H2,1-6H3/t21?,22?,25-,26?/m0/s1 |
| InChIKey | HCBRTCFUVLYSKU-YWSJGMOJSA-N |
| XLogP | 8.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|