C18H15N4NaOS3 — CID 44661653
sodium 12,12-dimethyl-8-oxo-7-phenyl-13,16-dithia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraene-3-thiolate (PubChem CID 44661653) has the molecular formula C18H15N4NaOS3 and a molecular weight of 422.54 g/mol. Its IUPAC name is sodium 12,12-dimethyl-8-oxo-7-phenyl-13,16-dithia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraene-3-thiolate.
| Compound Name | sodium 12,12-dimethyl-8-oxo-7-phenyl-13,16-dithia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraene-3-thiolate |
|---|---|
| PubChem CID | 44661653 |
| Molecular Formula | C18H15N4NaOS3 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | sodium 12,12-dimethyl-8-oxo-7-phenyl-13,16-dithia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraene-3-thiolate |
| SMILES | CC1(C)Cc2c(sc3c2c(=O)n(-c2ccccc2)c2nnc([S-])n32)CS1.[Na+] |
| InChI | InChI=1S/C18H16N4OS3.Na/c1-18(2)8-11-12(9-25-18)26-15-13(11)14(23)21(10-6-4-3-5-7-10)16-19-20-17(24)22(15)16;/h3-7H,8-9H2,1-2H3,(H,20,24);/q;+1/p-1 |
| InChIKey | BQYRMQPNZYWQJN-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|