C32H36N2O4S3 — CID 44669543
3-[(6E)-2-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-6-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-methylcyclohexen-1-yl]oxypropane-1-sulfonate (PubChem CID 44669543) has the molecular formula C32H36N2O4S3 and a molecular weight of 608.85 g/mol. Its IUPAC name is 3-[(6E)-2-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-6-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-methylcyclohexen-1-yl]oxypropane-1-sulfonate.
| Compound Name | 3-[(6E)-2-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-6-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-methylcyclohexen-1-yl]oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 44669543 |
| Molecular Formula | C32H36N2O4S3 |
| Molecular Weight | 608.85 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | 3-[(6E)-2-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-6-[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]-4-methylcyclohexen-1-yl]oxypropane-1-sulfonate |
| SMILES | CCN1/C(=C/C=C2\CC(C)CC(/C=C/c3sc4ccccc4[n+]3CC)=C2OCCCS(=O)(=O)[O-])Sc2ccccc21 |
| InChI | InChI=1S/C32H36N2O4S3/c1-4-33-26-11-6-8-13-28(26)39-30(33)17-15-24-21-23(3)22-25(32(24)38-19-10-20-41(35,36)37)16-18-31-34(5-2)27-12-7-9-14-29(27)40-31/h6-9,11-18,23H,4-5,10,19-22H2,1-3H3 |
| InChIKey | IONMKPLRPBECLN-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.85 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|