C16H18ClN3O3 — CID 44724912
N-[(Z)-butan-2-ylideneamino]-2-[4-chloro-5-methyl-2-(1,2-oxazol-5-yl)phenoxy]acetamide (PubChem CID 44724912) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is N-[(Z)-butan-2-ylideneamino]-2-[4-chloro-5-methyl-2-(1,2-oxazol-5-yl)phenoxy]acetamide.
| Compound Name | N-[(Z)-butan-2-ylideneamino]-2-[4-chloro-5-methyl-2-(1,2-oxazol-5-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 44724912 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-[(Z)-butan-2-ylideneamino]-2-[4-chloro-5-methyl-2-(1,2-oxazol-5-yl)phenoxy]acetamide |
| SMILES | CC/C(C)=N\NC(=O)COc1cc(C)c(Cl)cc1-c1ccno1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-4-11(3)19-20-16(21)9-22-15-7-10(2)13(17)8-12(15)14-5-6-18-23-14/h5-8H,4,9H2,1-3H3,(H,20,21)/b19-11- |
| InChIKey | FTTWNOPQMYWVTP-ODLFYWEKSA-N |
| XLogP | 3.58 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|