C12H19Cl2N5O2 — CID 44783937
1-N,1-N,3-N,3-N-tetramethyl-5-nitrobenzene-1,3-dicarboximidamide;dihydrochloride (PubChem CID 44783937) has the molecular formula C12H19Cl2N5O2 and a molecular weight of 336.22 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetramethyl-5-nitrobenzene-1,3-dicarboximidamide;dihydrochloride.
| Compound Name | 1-N,1-N,3-N,3-N-tetramethyl-5-nitrobenzene-1,3-dicarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 44783937 |
| Molecular Formula | C12H19Cl2N5O2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetramethyl-5-nitrobenzene-1,3-dicarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(/c1cc(/C(=N/[H])N(C)C)cc([N+](=O)[O-])c1)N(C)C |
| InChI | InChI=1S/C12H17N5O2.2ClH/c1-15(2)11(13)8-5-9(12(14)16(3)4)7-10(6-8)17(18)19;;/h5-7,13-14H,1-4H3;2*1H/b13-11-,14-12-;; |
| InChIKey | ITFLENGRCIXIPC-MVGPTFNUSA-N |
| XLogP | 2.21 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|