C23H17NO5 — CID 44815450
2-[5-hydroxy-2-(4-phenoxybenzoyl)indol-1-yl]acetic acid (PubChem CID 44815450) has the molecular formula C23H17NO5 and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-[5-hydroxy-2-(4-phenoxybenzoyl)indol-1-yl]acetic acid.
| Compound Name | 2-[5-hydroxy-2-(4-phenoxybenzoyl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 44815450 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-[5-hydroxy-2-(4-phenoxybenzoyl)indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(C(=O)c2ccc(Oc3ccccc3)cc2)cc2cc(O)ccc21 |
| InChI | InChI=1S/C23H17NO5/c25-17-8-11-20-16(12-17)13-21(24(20)14-22(26)27)23(28)15-6-9-19(10-7-15)29-18-4-2-1-3-5-18/h1-13,25H,14H2,(H,26,27) |
| InChIKey | NYTPVHJBAUALTO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |