C21H23N3O5S3 — CID 44827524
N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 44827524) has the molecular formula C21H23N3O5S3 and a molecular weight of 493.63 g/mol. Its IUPAC name is N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 44827524 |
| Molecular Formula | C21H23N3O5S3 |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)C2CCCN2S(=O)(=O)c2cccs2)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C21H23N3O5S3/c1-4-11-23-18-15(28-2)9-10-16(29-3)19(18)31-21(23)22-20(25)14-7-5-12-24(14)32(26,27)17-8-6-13-30-17/h4,6,8-10,13-14H,1,5,7,11-12H2,2-3H3/b22-21- |
| InChIKey | IHSOQNBJNPTNRD-DQRAZIAOSA-N |
| XLogP | 3.25 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|